C17H22N2O2 — CID 174422621
tert-butyl N-(1-amino-4-phenylcyclohexa-2,4-dien-1-yl)carbamate (PubChem CID 174422621) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is tert-butyl N-(1-amino-4-phenylcyclohexa-2,4-dien-1-yl)carbamate.
| Compound Name | tert-butyl N-(1-amino-4-phenylcyclohexa-2,4-dien-1-yl)carbamate |
|---|---|
| PubChem CID | 174422621 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | tert-butyl N-(1-amino-4-phenylcyclohexa-2,4-dien-1-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(N)C=CC(c2ccccc2)=CC1 |
| InChI | InChI=1S/C17H22N2O2/c1-16(2,3)21-15(20)19-17(18)11-9-14(10-12-17)13-7-5-4-6-8-13/h4-11H,12,18H2,1-3H3,(H,19,20) |
| InChIKey | CUSRIMUFKFOQIM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|