C11H19N3O2 — CID 141375794
tert-butyl N-(1,3-diaminocyclohexa-2,4-dien-1-yl)carbamate (PubChem CID 141375794) has the molecular formula C11H19N3O2 and a molecular weight of 225.29 g/mol. Its IUPAC name is tert-butyl N-(1,3-diaminocyclohexa-2,4-dien-1-yl)carbamate.
| Compound Name | tert-butyl N-(1,3-diaminocyclohexa-2,4-dien-1-yl)carbamate |
|---|---|
| PubChem CID | 141375794 |
| Molecular Formula | C11H19N3O2 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | tert-butyl N-(1,3-diaminocyclohexa-2,4-dien-1-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(N)C=C(N)C=CC1 |
| InChI | InChI=1S/C11H19N3O2/c1-10(2,3)16-9(15)14-11(13)6-4-5-8(12)7-11/h4-5,7H,6,12-13H2,1-3H3,(H,14,15) |
| InChIKey | JEUQTKGDKXARDI-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|