C12H19NO2 — CID 91074692
tert-butyl N-(3-methylcyclohexa-1,5-dien-1-yl)carbamate (PubChem CID 91074692) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is tert-butyl N-(3-methylcyclohexa-1,5-dien-1-yl)carbamate.
| Compound Name | tert-butyl N-(3-methylcyclohexa-1,5-dien-1-yl)carbamate |
|---|---|
| PubChem CID | 91074692 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | tert-butyl N-(3-methylcyclohexa-1,5-dien-1-yl)carbamate |
| SMILES | CC1C=C(NC(=O)OC(C)(C)C)C=CC1 |
| InChI | InChI=1S/C12H19NO2/c1-9-6-5-7-10(8-9)13-11(14)15-12(2,3)4/h5,7-9H,6H2,1-4H3,(H,13,14) |
| InChIKey | NSYVJZYERZBTRX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |