C15H17F2NO2 — CID 138979618
tert-butyl N-[(1R)-6,7-difluoro-1,2-dihydronaphthalen-1-yl]carbamate (PubChem CID 138979618) has the molecular formula C15H17F2NO2 and a molecular weight of 281.30 g/mol. Its IUPAC name is tert-butyl N-[(1R)-6,7-difluoro-1,2-dihydronaphthalen-1-yl]carbamate.
| Compound Name | tert-butyl N-[(1R)-6,7-difluoro-1,2-dihydronaphthalen-1-yl]carbamate |
|---|---|
| PubChem CID | 138979618 |
| Molecular Formula | C15H17F2NO2 |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | tert-butyl N-[(1R)-6,7-difluoro-1,2-dihydronaphthalen-1-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CC=Cc2cc(F)c(F)cc21 |
| InChI | InChI=1S/C15H17F2NO2/c1-15(2,3)20-14(19)18-13-6-4-5-9-7-11(16)12(17)8-10(9)13/h4-5,7-8,13H,6H2,1-3H3,(H,18,19)/t13-/m1/s1 |
| InChIKey | ZYKXILXXAQMVQO-CYBMUJFWSA-N |
| XLogP | 3.95 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |