C20H19F11N2O2 — CID 132508320
tert-butyl N-[(1R,2R)-6,7-difluoro-2-(2,2,3,3,4,4,5,5,5-nonafluoropentylamino)-1,2-dihydronaphthalen-1-yl]carbamate (PubChem CID 132508320) has the molecular formula C20H19F11N2O2 and a molecular weight of 528.36 g/mol. Its IUPAC name is tert-butyl N-[(1R,2R)-6,7-difluoro-2-(2,2,3,3,4,4,5,5,5-nonafluoropentylamino)-1,2-dihydronaphthalen-1-yl]carbamate.
| Compound Name | tert-butyl N-[(1R,2R)-6,7-difluoro-2-(2,2,3,3,4,4,5,5,5-nonafluoropentylamino)-1,2-dihydronaphthalen-1-yl]carbamate |
|---|---|
| PubChem CID | 132508320 |
| Molecular Formula | C20H19F11N2O2 |
| Molecular Weight | 528.36 g/mol |
| Exact Mass | 528.13 |
| IUPAC Name | tert-butyl N-[(1R,2R)-6,7-difluoro-2-(2,2,3,3,4,4,5,5,5-nonafluoropentylamino)-1,2-dihydronaphthalen-1-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1c2cc(F)c(F)cc2C=C[C@H]1NCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C20H19F11N2O2/c1-16(2,3)35-15(34)33-14-10-7-12(22)11(21)6-9(10)4-5-13(14)32-8-17(23,24)18(25,26)19(27,28)20(29,30)31/h4-7,13-14,32H,8H2,1-3H3,(H,33,34)/t13-,14-/m1/s1 |
| InChIKey | POJZQKRELRGECA-ZIAGYGMSSA-N |
| XLogP | 5.98 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.36 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|