C20H28N2O2 — CID 102588118
tert-butyl N-[(1R,2S)-2-piperidin-4-yl-1,2-dihydronaphthalen-1-yl]carbamate (PubChem CID 102588118) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is tert-butyl N-[(1R,2S)-2-piperidin-4-yl-1,2-dihydronaphthalen-1-yl]carbamate.
| Compound Name | tert-butyl N-[(1R,2S)-2-piperidin-4-yl-1,2-dihydronaphthalen-1-yl]carbamate |
|---|---|
| PubChem CID | 102588118 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | tert-butyl N-[(1R,2S)-2-piperidin-4-yl-1,2-dihydronaphthalen-1-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1c2ccccc2C=C[C@@H]1C1CCNCC1 |
| InChI | InChI=1S/C20H28N2O2/c1-20(2,3)24-19(23)22-18-16-7-5-4-6-14(16)8-9-17(18)15-10-12-21-13-11-15/h4-9,15,17-18,21H,10-13H2,1-3H3,(H,22,23)/t17-,18+/m1/s1 |
| InChIKey | QAEWSWNOTUIYMP-MSOLQXFVSA-N |
| XLogP | 3.89 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |