C15H23NO6 — CID 135019485
ethyl (1R,6S)-6-methyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]oxy-2-oxocyclohex-3-ene-1-carboxylate (PubChem CID 135019485) has the molecular formula C15H23NO6 and a molecular weight of 313.35 g/mol. Its IUPAC name is ethyl (1R,6S)-6-methyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]oxy-2-oxocyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl (1R,6S)-6-methyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]oxy-2-oxocyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 135019485 |
| Molecular Formula | C15H23NO6 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | ethyl (1R,6S)-6-methyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]oxy-2-oxocyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)[C@]1(ONC(=O)OC(C)(C)C)C(=O)C=CC[C@@H]1C |
| InChI | InChI=1S/C15H23NO6/c1-6-20-12(18)15(10(2)8-7-9-11(15)17)22-16-13(19)21-14(3,4)5/h7,9-10H,6,8H2,1-5H3,(H,16,19)/t10-,15+/m0/s1 |
| InChIKey | XHRCGGCQAZVJBC-ZUZCIYMTSA-N |
| XLogP | 1.91 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|