C16H27NO4 — CID 11630771
ethyl (1S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-propan-2-ylcyclopent-2-ene-1-carboxylate (PubChem CID 11630771) has the molecular formula C16H27NO4 and a molecular weight of 297.40 g/mol. Its IUPAC name is ethyl (1S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-propan-2-ylcyclopent-2-ene-1-carboxylate.
| Compound Name | ethyl (1S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-propan-2-ylcyclopent-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 11630771 |
| Molecular Formula | C16H27NO4 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | ethyl (1S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-propan-2-ylcyclopent-2-ene-1-carboxylate |
| SMILES | CCOC(=O)[C@]1(NC(=O)OC(C)(C)C)CCC=C1C(C)C |
| InChI | InChI=1S/C16H27NO4/c1-7-20-13(18)16(10-8-9-12(16)11(2)3)17-14(19)21-15(4,5)6/h9,11H,7-8,10H2,1-6H3,(H,17,19)/t16-/m0/s1 |
| InChIKey | BSODUCGQPALGOC-INIZCTEOSA-N |
| XLogP | 3.19 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|