C19H32N2O7 — CID 102072144
ethyl 1-[(2-methylpropan-2-yl)oxycarbonyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]-2-oxocyclohexane-1-carboxylate (PubChem CID 102072144) has the molecular formula C19H32N2O7 and a molecular weight of 400.47 g/mol. Its IUPAC name is ethyl 1-[(2-methylpropan-2-yl)oxycarbonyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]-2-oxocyclohexane-1-carboxylate.
| Compound Name | ethyl 1-[(2-methylpropan-2-yl)oxycarbonyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]-2-oxocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 102072144 |
| Molecular Formula | C19H32N2O7 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | ethyl 1-[(2-methylpropan-2-yl)oxycarbonyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]-2-oxocyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1(N(NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)CCCCC1=O |
| InChI | InChI=1S/C19H32N2O7/c1-8-26-14(23)19(12-10-9-11-13(19)22)21(16(25)28-18(5,6)7)20-15(24)27-17(2,3)4/h8-12H2,1-7H3,(H,20,24) |
| InChIKey | MNDOFZJTLMOLIB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|