C17H27N3O8 — CID 67342586
ethyl 3-[(2-methylpropan-2-yl)oxycarbonyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]-2,5-dioxopyrrolidine-3-carboxylate (PubChem CID 67342586) has the molecular formula C17H27N3O8 and a molecular weight of 401.42 g/mol. Its IUPAC name is ethyl 3-[(2-methylpropan-2-yl)oxycarbonyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]-2,5-dioxopyrrolidine-3-carboxylate.
| Compound Name | ethyl 3-[(2-methylpropan-2-yl)oxycarbonyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]-2,5-dioxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 67342586 |
| Molecular Formula | C17H27N3O8 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | ethyl 3-[(2-methylpropan-2-yl)oxycarbonyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]-2,5-dioxopyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)C1(N(NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)CC(=O)NC1=O |
| InChI | InChI=1S/C17H27N3O8/c1-8-26-12(23)17(9-10(21)18-11(17)22)20(14(25)28-16(5,6)7)19-13(24)27-15(2,3)4/h8-9H2,1-7H3,(H,19,24)(H,18,21,22) |
| InChIKey | CHOULEHQKGNLCZ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 140.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|