C17H28N2O7 — CID 134954351
methyl (1R)-1-[(2-methylpropan-2-yl)oxycarbonyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]-2-oxocyclopentane-1-carboxylate (PubChem CID 134954351) has the molecular formula C17H28N2O7 and a molecular weight of 372.42 g/mol. Its IUPAC name is methyl (1R)-1-[(2-methylpropan-2-yl)oxycarbonyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]-2-oxocyclopentane-1-carboxylate.
| Compound Name | methyl (1R)-1-[(2-methylpropan-2-yl)oxycarbonyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]-2-oxocyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 134954351 |
| Molecular Formula | C17H28N2O7 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | methyl (1R)-1-[(2-methylpropan-2-yl)oxycarbonyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]-2-oxocyclopentane-1-carboxylate |
| SMILES | COC(=O)[C@@]1(N(NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)CCCC1=O |
| InChI | InChI=1S/C17H28N2O7/c1-15(2,3)25-13(22)18-19(14(23)26-16(4,5)6)17(12(21)24-7)10-8-9-11(17)20/h8-10H2,1-7H3,(H,18,22)/t17-/m1/s1 |
| InChIKey | NATCFTVUVZDBMZ-QGZVFWFLSA-N |
| XLogP | 2.33 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|