C21H26N2O9 — CID 132596851
tert-butyl (6R)-6-[ethoxycarbonyl-(ethoxycarbonylamino)amino]-7-oxo-5H-cyclopenta[f][1,3]benzodioxole-6-carboxylate (PubChem CID 132596851) has the molecular formula C21H26N2O9 and a molecular weight of 450.44 g/mol. Its IUPAC name is tert-butyl (6R)-6-[ethoxycarbonyl-(ethoxycarbonylamino)amino]-7-oxo-5H-cyclopenta[f][1,3]benzodioxole-6-carboxylate.
| Compound Name | tert-butyl (6R)-6-[ethoxycarbonyl-(ethoxycarbonylamino)amino]-7-oxo-5H-cyclopenta[f][1,3]benzodioxole-6-carboxylate |
|---|---|
| PubChem CID | 132596851 |
| Molecular Formula | C21H26N2O9 |
| Molecular Weight | 450.44 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | tert-butyl (6R)-6-[ethoxycarbonyl-(ethoxycarbonylamino)amino]-7-oxo-5H-cyclopenta[f][1,3]benzodioxole-6-carboxylate |
| SMILES | CCOC(=O)NN(C(=O)OCC)[C@]1(C(=O)OC(C)(C)C)Cc2cc3c(cc2C1=O)OCO3 |
| InChI | InChI=1S/C21H26N2O9/c1-6-28-18(26)22-23(19(27)29-7-2)21(17(25)32-20(3,4)5)10-12-8-14-15(31-11-30-14)9-13(12)16(21)24/h8-9H,6-7,10-11H2,1-5H3,(H,22,26)/t21-/m1/s1 |
| InChIKey | PMTYXGRMIOAGIC-OAQYLSRUSA-N |
| XLogP | 2.35 |
| TPSA | 129.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.44 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|