C14H24N2O6 — CID 122397846
ethyl (3R)-3-[methoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-oxopyrrolidine-3-carboxylate (PubChem CID 122397846) has the molecular formula C14H24N2O6 and a molecular weight of 316.35 g/mol. Its IUPAC name is ethyl (3R)-3-[methoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-oxopyrrolidine-3-carboxylate.
| Compound Name | ethyl (3R)-3-[methoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 122397846 |
| Molecular Formula | C14H24N2O6 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | ethyl (3R)-3-[methoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-oxopyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@]1(N(COC)C(=O)OC(C)(C)C)CCNC1=O |
| InChI | InChI=1S/C14H24N2O6/c1-6-21-11(18)14(7-8-15-10(14)17)16(9-20-5)12(19)22-13(2,3)4/h6-9H2,1-5H3,(H,15,17)/t14-/m1/s1 |
| InChIKey | CNRBYNCIYVBZRO-CQSZACIVSA-N |
| XLogP | 0.65 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|