C13H19NO5 — CID 90876274
tert-butyl N-ethoxycarbonyl-N-(3-oxocyclopenten-1-yl)carbamate (PubChem CID 90876274) has the molecular formula C13H19NO5 and a molecular weight of 269.30 g/mol. Its IUPAC name is tert-butyl N-ethoxycarbonyl-N-(3-oxocyclopenten-1-yl)carbamate.
| Compound Name | tert-butyl N-ethoxycarbonyl-N-(3-oxocyclopenten-1-yl)carbamate |
|---|---|
| PubChem CID | 90876274 |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | tert-butyl N-ethoxycarbonyl-N-(3-oxocyclopenten-1-yl)carbamate |
| SMILES | CCOC(=O)N(C(=O)OC(C)(C)C)C1=CC(=O)CC1 |
| InChI | InChI=1S/C13H19NO5/c1-5-18-11(16)14(9-6-7-10(15)8-9)12(17)19-13(2,3)4/h8H,5-7H2,1-4H3 |
| InChIKey | VGWMSLNKMBHDOZ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |