C22H31N3O6 — CID 71132864
ethyl 5-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-phenyl-3,4-dihydropyrazole-4-carboxylate (PubChem CID 71132864) has the molecular formula C22H31N3O6 and a molecular weight of 433.51 g/mol. Its IUPAC name is ethyl 5-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-phenyl-3,4-dihydropyrazole-4-carboxylate.
| Compound Name | ethyl 5-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-phenyl-3,4-dihydropyrazole-4-carboxylate |
|---|---|
| PubChem CID | 71132864 |
| Molecular Formula | C22H31N3O6 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | ethyl 5-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-phenyl-3,4-dihydropyrazole-4-carboxylate |
| SMILES | CCOC(=O)C1CN(c2ccccc2)N=C1N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H31N3O6/c1-8-29-18(26)16-14-24(15-12-10-9-11-13-15)23-17(16)25(19(27)30-21(2,3)4)20(28)31-22(5,6)7/h9-13,16H,8,14H2,1-7H3 |
| InChIKey | ZXWJLWVBDPAHNW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 97.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|