C20H28N2O4 — CID 57258449
1-O-tert-butyl 3-O-ethyl 4-benzyliminopiperidine-1,3-dicarboxylate (PubChem CID 57258449) has the molecular formula C20H28N2O4 and a molecular weight of 360.45 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-ethyl 4-benzyliminopiperidine-1,3-dicarboxylate.
| Compound Name | 1-O-tert-butyl 3-O-ethyl 4-benzyliminopiperidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 57258449 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 1-O-tert-butyl 3-O-ethyl 4-benzyliminopiperidine-1,3-dicarboxylate |
| SMILES | CCOC(=O)C1CN(C(=O)OC(C)(C)C)CC/C1=N\Cc1ccccc1 |
| InChI | InChI=1S/C20H28N2O4/c1-5-25-18(23)16-14-22(19(24)26-20(2,3)4)12-11-17(16)21-13-15-9-7-6-8-10-15/h6-10,16H,5,11-14H2,1-4H3/b21-17+ |
| InChIKey | CHQZBMRJKYMWDT-HEHNFIMWSA-N |
| XLogP | 3.45 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|