C27H34N2O3 — CID 91436094
ethyl 1-(4-tert-butylbenzoyl)-4-(2-phenylethylimino)piperidine-3-carboxylate (PubChem CID 91436094) has the molecular formula C27H34N2O3 and a molecular weight of 434.58 g/mol. Its IUPAC name is ethyl 1-(4-tert-butylbenzoyl)-4-(2-phenylethylimino)piperidine-3-carboxylate.
| Compound Name | ethyl 1-(4-tert-butylbenzoyl)-4-(2-phenylethylimino)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 91436094 |
| Molecular Formula | C27H34N2O3 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.26 |
| IUPAC Name | ethyl 1-(4-tert-butylbenzoyl)-4-(2-phenylethylimino)piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CN(C(=O)c2ccc(C(C)(C)C)cc2)CC/C1=N\CCc1ccccc1 |
| InChI | InChI=1S/C27H34N2O3/c1-5-32-26(31)23-19-29(25(30)21-11-13-22(14-12-21)27(2,3)4)18-16-24(23)28-17-15-20-9-7-6-8-10-20/h6-14,23H,5,15-19H2,1-4H3/b28-24+ |
| InChIKey | QXIAQRUBIDALSO-ZZIIXHQDSA-N |
| XLogP | 4.69 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|