C24H32N2O — CID 110657689
(4-benzyl-3,5-dimethylpiperazin-1-yl)-(4-tert-butylphenyl)methanone (PubChem CID 110657689) has the molecular formula C24H32N2O and a molecular weight of 364.53 g/mol. Its IUPAC name is (4-benzyl-3,5-dimethylpiperazin-1-yl)-(4-tert-butylphenyl)methanone.
| Compound Name | (4-benzyl-3,5-dimethylpiperazin-1-yl)-(4-tert-butylphenyl)methanone |
|---|---|
| PubChem CID | 110657689 |
| Molecular Formula | C24H32N2O |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | (4-benzyl-3,5-dimethylpiperazin-1-yl)-(4-tert-butylphenyl)methanone |
| SMILES | CC1CN(C(=O)c2ccc(C(C)(C)C)cc2)CC(C)N1Cc1ccccc1 |
| InChI | InChI=1S/C24H32N2O/c1-18-15-25(16-19(2)26(18)17-20-9-7-6-8-10-20)23(27)21-11-13-22(14-12-21)24(3,4)5/h6-14,18-19H,15-17H2,1-5H3 |
| InChIKey | ICABATNROMUCPC-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |