C16H28N2O6 — CID 122397845
tert-butyl (3S)-3-[methoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-oxopyrrolidine-3-carboxylate (PubChem CID 122397845) has the molecular formula C16H28N2O6 and a molecular weight of 344.41 g/mol. Its IUPAC name is tert-butyl (3S)-3-[methoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-oxopyrrolidine-3-carboxylate.
| Compound Name | tert-butyl (3S)-3-[methoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 122397845 |
| Molecular Formula | C16H28N2O6 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | tert-butyl (3S)-3-[methoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-oxopyrrolidine-3-carboxylate |
| SMILES | COCN(C(=O)OC(C)(C)C)[C@@]1(C(=O)OC(C)(C)C)CCNC1=O |
| InChI | InChI=1S/C16H28N2O6/c1-14(2,3)23-12(20)16(8-9-17-11(16)19)18(10-22-7)13(21)24-15(4,5)6/h8-10H2,1-7H3,(H,17,19)/t16-/m0/s1 |
| InChIKey | FCRRSQGROMSLJG-INIZCTEOSA-N |
| XLogP | 1.43 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|