C14H27NO4Si — CID 170603681
ethyl 3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-oxopyrrolidine-3-carboxylate (PubChem CID 170603681) has the molecular formula C14H27NO4Si and a molecular weight of 301.46 g/mol. Its IUPAC name is ethyl 3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-oxopyrrolidine-3-carboxylate.
| Compound Name | ethyl 3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 170603681 |
| Molecular Formula | C14H27NO4Si |
| Molecular Weight | 301.46 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | ethyl 3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-oxopyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)C1(CO[Si](C)(C)C(C)(C)C)CCNC1=O |
| InChI | InChI=1S/C14H27NO4Si/c1-7-18-12(17)14(8-9-15-11(14)16)10-19-20(5,6)13(2,3)4/h7-10H2,1-6H3,(H,15,16) |
| InChIKey | KYZYUAZBWPBEHZ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.46 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|