C20H32O5Si2 — CID 71603292
diethyl 5-oxo-4,6-bis(trimethylsilyl)-1,3-dihydropentalene-2,2-dicarboxylate (PubChem CID 71603292) has the molecular formula C20H32O5Si2 and a molecular weight of 408.64 g/mol. Its IUPAC name is diethyl 5-oxo-4,6-bis(trimethylsilyl)-1,3-dihydropentalene-2,2-dicarboxylate.
| Compound Name | diethyl 5-oxo-4,6-bis(trimethylsilyl)-1,3-dihydropentalene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 71603292 |
| Molecular Formula | C20H32O5Si2 |
| Molecular Weight | 408.64 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | diethyl 5-oxo-4,6-bis(trimethylsilyl)-1,3-dihydropentalene-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC2=C([Si](C)(C)C)C(=O)C([Si](C)(C)C)=C2C1 |
| InChI | InChI=1S/C20H32O5Si2/c1-9-24-18(22)20(19(23)25-10-2)11-13-14(12-20)17(27(6,7)8)15(21)16(13)26(3,4)5/h9-12H2,1-8H3 |
| InChIKey | RYHRQDCIJUKGRD-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.64 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|