C16H18O4 — CID 15641549
diethyl 3,5-dihydro-1H-cyclopropa[f]indene-4,4-dicarboxylate (PubChem CID 15641549) has the molecular formula C16H18O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is diethyl 3,5-dihydro-1H-cyclopropa[f]indene-4,4-dicarboxylate.
| Compound Name | diethyl 3,5-dihydro-1H-cyclopropa[f]indene-4,4-dicarboxylate |
|---|---|
| PubChem CID | 15641549 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | diethyl 3,5-dihydro-1H-cyclopropa[f]indene-4,4-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)Cc2cc3c(cc2C1)C3 |
| InChI | InChI=1S/C16H18O4/c1-3-19-14(17)16(15(18)20-4-2)8-12-6-10-5-11(10)7-13(12)9-16/h6-7H,3-5,8-9H2,1-2H3 |
| InChIKey | ZNIGPWWMQUDRQQ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|