C20H30N2O4 — CID 102296543
diethyl 2-propan-2-yl-3-propan-2-ylimino-5,7-dihydrocyclopenta[c]pyridine-6,6-dicarboxylate (PubChem CID 102296543) has the molecular formula C20H30N2O4 and a molecular weight of 362.47 g/mol. Its IUPAC name is diethyl 2-propan-2-yl-3-propan-2-ylimino-5,7-dihydrocyclopenta[c]pyridine-6,6-dicarboxylate.
| Compound Name | diethyl 2-propan-2-yl-3-propan-2-ylimino-5,7-dihydrocyclopenta[c]pyridine-6,6-dicarboxylate |
|---|---|
| PubChem CID | 102296543 |
| Molecular Formula | C20H30N2O4 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | diethyl 2-propan-2-yl-3-propan-2-ylimino-5,7-dihydrocyclopenta[c]pyridine-6,6-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)Cc2c/c(=N\C(C)C)n(C(C)C)cc2C1 |
| InChI | InChI=1S/C20H30N2O4/c1-7-25-18(23)20(19(24)26-8-2)10-15-9-17(21-13(3)4)22(14(5)6)12-16(15)11-20/h9,12-14H,7-8,10-11H2,1-6H3/b21-17+ |
| InChIKey | SHRYYOUUDRVIBM-HEHNFIMWSA-N |
| XLogP | 2.59 |
| TPSA | 69.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|