C22H21NO4 — CID 177485996
diethyl 3-(2-phenylethynyl)-5,7-dihydrocyclopenta[c]pyridine-6,6-dicarboxylate (PubChem CID 177485996) has the molecular formula C22H21NO4 and a molecular weight of 363.41 g/mol. Its IUPAC name is diethyl 3-(2-phenylethynyl)-5,7-dihydrocyclopenta[c]pyridine-6,6-dicarboxylate.
| Compound Name | diethyl 3-(2-phenylethynyl)-5,7-dihydrocyclopenta[c]pyridine-6,6-dicarboxylate |
|---|---|
| PubChem CID | 177485996 |
| Molecular Formula | C22H21NO4 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | diethyl 3-(2-phenylethynyl)-5,7-dihydrocyclopenta[c]pyridine-6,6-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)Cc2cnc(C#Cc3ccccc3)cc2C1 |
| InChI | InChI=1S/C22H21NO4/c1-3-26-20(24)22(21(25)27-4-2)13-17-12-19(23-15-18(17)14-22)11-10-16-8-6-5-7-9-16/h5-9,12,15H,3-4,13-14H2,1-2H3 |
| InChIKey | WQWXOMFOQHUPMU-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|