C33H33ClO6 — CID 102129525
diethyl 7-chloro-5-(4-ethoxyphenyl)-4-[2-(4-ethoxyphenyl)ethynyl]-1,3-dihydroindene-2,2-dicarboxylate (PubChem CID 102129525) has the molecular formula C33H33ClO6 and a molecular weight of 561.07 g/mol. Its IUPAC name is diethyl 7-chloro-5-(4-ethoxyphenyl)-4-[2-(4-ethoxyphenyl)ethynyl]-1,3-dihydroindene-2,2-dicarboxylate.
| Compound Name | diethyl 7-chloro-5-(4-ethoxyphenyl)-4-[2-(4-ethoxyphenyl)ethynyl]-1,3-dihydroindene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 102129525 |
| Molecular Formula | C33H33ClO6 |
| Molecular Weight | 561.07 g/mol |
| Exact Mass | 560.20 |
| IUPAC Name | diethyl 7-chloro-5-(4-ethoxyphenyl)-4-[2-(4-ethoxyphenyl)ethynyl]-1,3-dihydroindene-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)Cc2c(Cl)cc(-c3ccc(OCC)cc3)c(C#Cc3ccc(OCC)cc3)c2C1 |
| InChI | InChI=1S/C33H33ClO6/c1-5-37-24-14-9-22(10-15-24)11-18-26-27(23-12-16-25(17-13-23)38-6-2)19-30(34)29-21-33(20-28(26)29,31(35)39-7-3)32(36)40-8-4/h9-10,12-17,19H,5-8,20-21H2,1-4H3 |
| InChIKey | RHFVJXCZQGMHHK-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.07 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|