C23H23NO5 — CID 177487752
diethyl 5-cyano-6-(4-methoxyphenyl)-1,3-dihydroindene-2,2-dicarboxylate (PubChem CID 177487752) has the molecular formula C23H23NO5 and a molecular weight of 393.44 g/mol. Its IUPAC name is diethyl 5-cyano-6-(4-methoxyphenyl)-1,3-dihydroindene-2,2-dicarboxylate.
| Compound Name | diethyl 5-cyano-6-(4-methoxyphenyl)-1,3-dihydroindene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 177487752 |
| Molecular Formula | C23H23NO5 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | diethyl 5-cyano-6-(4-methoxyphenyl)-1,3-dihydroindene-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)Cc2cc(C#N)c(-c3ccc(OC)cc3)cc2C1 |
| InChI | InChI=1S/C23H23NO5/c1-4-28-21(25)23(22(26)29-5-2)12-16-10-18(14-24)20(11-17(16)13-23)15-6-8-19(27-3)9-7-15/h6-11H,4-5,12-13H2,1-3H3 |
| InChIKey | XPRWWAOTHBYZNS-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 85.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|