C46H54O10 — CID 158727907
diethyl 5-(hydroxymethyl)-6-[(4-methoxyphenyl)methyl]-1,3-dihydroindene-2,2-dicarboxylate;ethyl 2-methyl-2-prop-2-ynylpent-4-ynoate;4-(4-methoxyphenyl)but-2-yn-1-ol (PubChem CID 158727907) has the molecular formula C46H54O10 and a molecular weight of 766.93 g/mol. Its IUPAC name is diethyl 5-(hydroxymethyl)-6-[(4-methoxyphenyl)methyl]-1,3-dihydroindene-2,2-dicarboxylate;ethyl 2-methyl-2-prop-2-ynylpent-4-ynoate;4-(4-methoxyphenyl)but-2-yn-1-ol.
| Compound Name | diethyl 5-(hydroxymethyl)-6-[(4-methoxyphenyl)methyl]-1,3-dihydroindene-2,2-dicarboxylate;ethyl 2-methyl-2-prop-2-ynylpent-4-ynoate;4-(4-methoxyphenyl)but-2-yn-1-ol |
|---|---|
| PubChem CID | 158727907 |
| Molecular Formula | C46H54O10 |
| Molecular Weight | 766.93 g/mol |
| Exact Mass | 766.37 |
| IUPAC Name | diethyl 5-(hydroxymethyl)-6-[(4-methoxyphenyl)methyl]-1,3-dihydroindene-2,2-dicarboxylate;ethyl 2-methyl-2-prop-2-ynylpent-4-ynoate;4-(4-methoxyphenyl)but-2-yn-1-ol |
| SMILES | C#CCC(C)(CC#C)C(=O)OCC.CCOC(=O)C1(C(=O)OCC)Cc2cc(CO)c(Cc3ccc(OC)cc3)cc2C1.COc1ccc(CC#CCO)cc1 |
| InChI | InChI=1S/C24H28O6.C11H12O2.C11H14O2/c1-4-29-22(26)24(23(27)30-5-2)13-18-11-17(20(15-25)12-19(18)14-24)10-16-6-8-21(28-3)9-7-16;1-13-11-7-5-10(6-8-11)4-2-3-9-12;1-5-8-11(4,9-6-2)10(12)13-7-3/h6-9,11-12,25H,4-5,10,13-15H2,1-3H3;5-8,12H,4,9H2,1H3;1-2H,7-9H2,3-4H3 |
| InChIKey | IKSVPJUXTNAFDH-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 137.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.93 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|