C19H23F3O5 — CID 102097123
diethyl 6-methoxy-4-(2,2,2-trifluoroethyl)-3,4-dihydro-1H-naphthalene-2,2-dicarboxylate (PubChem CID 102097123) has the molecular formula C19H23F3O5 and a molecular weight of 388.38 g/mol. Its IUPAC name is diethyl 6-methoxy-4-(2,2,2-trifluoroethyl)-3,4-dihydro-1H-naphthalene-2,2-dicarboxylate.
| Compound Name | diethyl 6-methoxy-4-(2,2,2-trifluoroethyl)-3,4-dihydro-1H-naphthalene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 102097123 |
| Molecular Formula | C19H23F3O5 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | diethyl 6-methoxy-4-(2,2,2-trifluoroethyl)-3,4-dihydro-1H-naphthalene-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)Cc2ccc(OC)cc2C(CC(F)(F)F)C1 |
| InChI | InChI=1S/C19H23F3O5/c1-4-26-16(23)18(17(24)27-5-2)9-12-6-7-14(25-3)8-15(12)13(10-18)11-19(20,21)22/h6-8,13H,4-5,9-11H2,1-3H3 |
| InChIKey | LXYZSYPWXYGKPC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|