C22H23NO9 — CID 142742453
3',3',4',4',5',5'-hexahydroxy-6-(4-methoxyphenyl)-6',6'-dimethylspiro[3H-2-benzofuran-1,2'-oxane]-5-carbonitrile (PubChem CID 142742453) has the molecular formula C22H23NO9 and a molecular weight of 445.42 g/mol. Its IUPAC name is 3',3',4',4',5',5'-hexahydroxy-6-(4-methoxyphenyl)-6',6'-dimethylspiro[3H-2-benzofuran-1,2'-oxane]-5-carbonitrile.
| Compound Name | 3',3',4',4',5',5'-hexahydroxy-6-(4-methoxyphenyl)-6',6'-dimethylspiro[3H-2-benzofuran-1,2'-oxane]-5-carbonitrile |
|---|---|
| PubChem CID | 142742453 |
| Molecular Formula | C22H23NO9 |
| Molecular Weight | 445.42 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | 3',3',4',4',5',5'-hexahydroxy-6-(4-methoxyphenyl)-6',6'-dimethylspiro[3H-2-benzofuran-1,2'-oxane]-5-carbonitrile |
| SMILES | COc1ccc(-c2cc3c(cc2C#N)COC32OC(C)(C)C(O)(O)C(O)(O)C2(O)O)cc1 |
| InChI | InChI=1S/C22H23NO9/c1-18(2)20(24,25)22(28,29)21(26,27)19(32-18)17-9-16(12-4-6-15(30-3)7-5-12)13(10-23)8-14(17)11-31-19/h4-9,24-29H,11H2,1-3H3 |
| InChIKey | JBJOOUQGHJREAV-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 172.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.42 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|