C19H24O6 — CID 59398642
triethyl 6-methyl-1,3-dihydroindene-2,2,5-tricarboxylate (PubChem CID 59398642) has the molecular formula C19H24O6 and a molecular weight of 348.40 g/mol. Its IUPAC name is triethyl 6-methyl-1,3-dihydroindene-2,2,5-tricarboxylate.
| Compound Name | triethyl 6-methyl-1,3-dihydroindene-2,2,5-tricarboxylate |
|---|---|
| PubChem CID | 59398642 |
| Molecular Formula | C19H24O6 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | triethyl 6-methyl-1,3-dihydroindene-2,2,5-tricarboxylate |
| SMILES | CCOC(=O)c1cc2c(cc1C)CC(C(=O)OCC)(C(=O)OCC)C2 |
| InChI | InChI=1S/C19H24O6/c1-5-23-16(20)15-9-14-11-19(17(21)24-6-2,18(22)25-7-3)10-13(14)8-12(15)4/h8-9H,5-7,10-11H2,1-4H3 |
| InChIKey | BMPYGUYXUHCCBT-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|