C24H26O7P+ — CID 132546992
[6-ethoxycarbonyl-3,3-bis(methoxycarbonyl)-7-methyl-2,4-dihydro-1H-naphthalen-1-yl]-oxo-phenylphosphanium (PubChem CID 132546992) has the molecular formula C24H26O7P+ and a molecular weight of 457.44 g/mol. Its IUPAC name is [6-ethoxycarbonyl-3,3-bis(methoxycarbonyl)-7-methyl-2,4-dihydro-1H-naphthalen-1-yl]-oxo-phenylphosphanium.
| Compound Name | [6-ethoxycarbonyl-3,3-bis(methoxycarbonyl)-7-methyl-2,4-dihydro-1H-naphthalen-1-yl]-oxo-phenylphosphanium |
|---|---|
| PubChem CID | 132546992 |
| Molecular Formula | C24H26O7P+ |
| Molecular Weight | 457.44 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | [6-ethoxycarbonyl-3,3-bis(methoxycarbonyl)-7-methyl-2,4-dihydro-1H-naphthalen-1-yl]-oxo-phenylphosphanium |
| SMILES | CCOC(=O)c1cc2c(cc1C)C([P+](=O)c1ccccc1)CC(C(=O)OC)(C(=O)OC)C2 |
| InChI | InChI=1S/C24H26O7P/c1-5-31-21(25)18-12-16-13-24(22(26)29-3,23(27)30-4)14-20(19(16)11-15(18)2)32(28)17-9-7-6-8-10-17/h6-12,20H,5,13-14H2,1-4H3/q+1 |
| InChIKey | PSIOAJXVNPRJIY-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|