C15H18O5 — CID 134929299
dimethyl 5-hydroxy-4,6-dimethyl-1,3-dihydroindene-2,2-dicarboxylate (PubChem CID 134929299) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is dimethyl 5-hydroxy-4,6-dimethyl-1,3-dihydroindene-2,2-dicarboxylate.
| Compound Name | dimethyl 5-hydroxy-4,6-dimethyl-1,3-dihydroindene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 134929299 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | dimethyl 5-hydroxy-4,6-dimethyl-1,3-dihydroindene-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)Cc2cc(C)c(O)c(C)c2C1 |
| InChI | InChI=1S/C15H18O5/c1-8-5-10-6-15(13(17)19-3,14(18)20-4)7-11(10)9(2)12(8)16/h5,16H,6-7H2,1-4H3 |
| InChIKey | AVDOAKWRKDQGAL-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|