C22H25NO5 — CID 101351000
dimethyl 2-(2,6-dimethylphenyl)-1,4-dimethyl-3-oxo-5,7-dihydrocyclopenta[c]pyridine-6,6-dicarboxylate (PubChem CID 101351000) has the molecular formula C22H25NO5 and a molecular weight of 383.44 g/mol. Its IUPAC name is dimethyl 2-(2,6-dimethylphenyl)-1,4-dimethyl-3-oxo-5,7-dihydrocyclopenta[c]pyridine-6,6-dicarboxylate.
| Compound Name | dimethyl 2-(2,6-dimethylphenyl)-1,4-dimethyl-3-oxo-5,7-dihydrocyclopenta[c]pyridine-6,6-dicarboxylate |
|---|---|
| PubChem CID | 101351000 |
| Molecular Formula | C22H25NO5 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | dimethyl 2-(2,6-dimethylphenyl)-1,4-dimethyl-3-oxo-5,7-dihydrocyclopenta[c]pyridine-6,6-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)Cc2c(c(C)n(-c3c(C)cccc3C)c(=O)c2C)C1 |
| InChI | InChI=1S/C22H25NO5/c1-12-8-7-9-13(2)18(12)23-15(4)17-11-22(20(25)27-5,21(26)28-6)10-16(17)14(3)19(23)24/h7-9H,10-11H2,1-6H3 |
| InChIKey | NDDQGKGPRYAMSV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 74.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|