C17H24O4Si — CID 11544278
dimethyl 4-methyl-6-trimethylsilyl-1,3-dihydroindene-2,2-dicarboxylate (PubChem CID 11544278) has the molecular formula C17H24O4Si and a molecular weight of 320.46 g/mol. Its IUPAC name is dimethyl 4-methyl-6-trimethylsilyl-1,3-dihydroindene-2,2-dicarboxylate.
| Compound Name | dimethyl 4-methyl-6-trimethylsilyl-1,3-dihydroindene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 11544278 |
| Molecular Formula | C17H24O4Si |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | dimethyl 4-methyl-6-trimethylsilyl-1,3-dihydroindene-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)Cc2cc([Si](C)(C)C)cc(C)c2C1 |
| InChI | InChI=1S/C17H24O4Si/c1-11-7-13(22(4,5)6)8-12-9-17(10-14(11)12,15(18)20-2)16(19)21-3/h7-8H,9-10H2,1-6H3 |
| InChIKey | ONXABZFKKKFCRR-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|