C17H18O8 — CID 11727810
tetramethyl 1,3-dihydroindene-2,2,4,6-tetracarboxylate (PubChem CID 11727810) has the molecular formula C17H18O8 and a molecular weight of 350.32 g/mol. Its IUPAC name is tetramethyl 1,3-dihydroindene-2,2,4,6-tetracarboxylate.
| Compound Name | tetramethyl 1,3-dihydroindene-2,2,4,6-tetracarboxylate |
|---|---|
| PubChem CID | 11727810 |
| Molecular Formula | C17H18O8 |
| Molecular Weight | 350.32 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | tetramethyl 1,3-dihydroindene-2,2,4,6-tetracarboxylate |
| SMILES | COC(=O)c1cc2c(c(C(=O)OC)c1)CC(C(=O)OC)(C(=O)OC)C2 |
| InChI | InChI=1S/C17H18O8/c1-22-13(18)9-5-10-7-17(15(20)24-3,16(21)25-4)8-12(10)11(6-9)14(19)23-2/h5-6H,7-8H2,1-4H3 |
| InChIKey | HTTPGPZVEXSHNR-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.32 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|