C15H16O5 — CID 10468672
dimethyl 2-acetyl-1,3-dihydroindene-2,5-dicarboxylate (PubChem CID 10468672) has the molecular formula C15H16O5 and a molecular weight of 276.29 g/mol. Its IUPAC name is dimethyl 2-acetyl-1,3-dihydroindene-2,5-dicarboxylate.
| Compound Name | dimethyl 2-acetyl-1,3-dihydroindene-2,5-dicarboxylate |
|---|---|
| PubChem CID | 10468672 |
| Molecular Formula | C15H16O5 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | dimethyl 2-acetyl-1,3-dihydroindene-2,5-dicarboxylate |
| SMILES | COC(=O)c1ccc2c(c1)CC(C(C)=O)(C(=O)OC)C2 |
| InChI | InChI=1S/C15H16O5/c1-9(16)15(14(18)20-3)7-11-5-4-10(13(17)19-2)6-12(11)8-15/h4-6H,7-8H2,1-3H3 |
| InChIKey | GRABVXAYSZLNTN-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|