C16H20O5 — CID 102101101
dimethyl 5-(3-hydroxypropyl)-1,3-dihydroindene-2,2-dicarboxylate (PubChem CID 102101101) has the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. Its IUPAC name is dimethyl 5-(3-hydroxypropyl)-1,3-dihydroindene-2,2-dicarboxylate.
| Compound Name | dimethyl 5-(3-hydroxypropyl)-1,3-dihydroindene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 102101101 |
| Molecular Formula | C16H20O5 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | dimethyl 5-(3-hydroxypropyl)-1,3-dihydroindene-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)Cc2ccc(CCCO)cc2C1 |
| InChI | InChI=1S/C16H20O5/c1-20-14(18)16(15(19)21-2)9-12-6-5-11(4-3-7-17)8-13(12)10-16/h5-6,8,17H,3-4,7,9-10H2,1-2H3 |
| InChIKey | ZZOIXRIXEWIDNA-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|