C16H17NO4 — CID 140747798
methyl 6-isocyano-6-(2-methoxy-2-oxoethyl)-7,8-dihydro-5H-naphthalene-2-carboxylate (PubChem CID 140747798) has the molecular formula C16H17NO4 and a molecular weight of 287.32 g/mol. Its IUPAC name is methyl 6-isocyano-6-(2-methoxy-2-oxoethyl)-7,8-dihydro-5H-naphthalene-2-carboxylate.
| Compound Name | methyl 6-isocyano-6-(2-methoxy-2-oxoethyl)-7,8-dihydro-5H-naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 140747798 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | methyl 6-isocyano-6-(2-methoxy-2-oxoethyl)-7,8-dihydro-5H-naphthalene-2-carboxylate |
| SMILES | [C-]#[N+]C1(CC(=O)OC)CCc2cc(C(=O)OC)ccc2C1 |
| InChI | InChI=1S/C16H17NO4/c1-17-16(10-14(18)20-2)7-6-11-8-12(15(19)21-3)4-5-13(11)9-16/h4-5,8H,6-7,9-10H2,2-3H3 |
| InChIKey | XPLMUNHDETZJHT-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 56.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|