methyl 6,6-diethyl-5-oxo-7,8-dihydronaphthalene-2-carboxylate

C16H20O3 — CID 102085766

IUPACmethyl 6,6-diethyl-5-oxo-7,8-dihydronaphthalene-2-carboxylate
SMILESCCC1(CC)CCc2cc(C(=O)OC)ccc2C1=O
InChIInChI=1S/C16H20O3/c1-4-16(5-2)9-8-11-10-12(15(18)19-3)6-7-13(11)14(16)17/h6-7,10H,4-5,8-9H2,1-3H3
InChIKeyVRBNTNJAWXPWEB-UHFFFAOYSA-N
MW260.33 g/mol
LogP3.41
Rot. Bonds3

About methyl 6,6-diethyl-5-oxo-7,8-dihydronaphthalene-2-carboxylate

methyl 6,6-diethyl-5-oxo-7,8-dihydronaphthalene-2-carboxylate (PubChem CID 102085766) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is methyl 6,6-diethyl-5-oxo-7,8-dihydronaphthalene-2-carboxylate.

Molecular Properties

Compound Namemethyl 6,6-diethyl-5-oxo-7,8-dihydronaphthalene-2-carboxylate
PubChem CID102085766
Molecular FormulaC16H20O3
Molecular Weight260.33 g/mol
Exact Mass260.14
IUPAC Namemethyl 6,6-diethyl-5-oxo-7,8-dihydronaphthalene-2-carboxylate
SMILESCCC1(CC)CCc2cc(C(=O)OC)ccc2C1=O
InChIInChI=1S/C16H20O3/c1-4-16(5-2)9-8-11-10-12(15(18)19-3)6-7-13(11)14(16)17/h6-7,10H,4-5,8-9H2,1-3H3
InChIKeyVRBNTNJAWXPWEB-UHFFFAOYSA-N
XLogP3.41
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.33
LogP ≤ 53.41
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 6,6-diethyl-5-oxo-7,8-dihydronaphthalene-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 6,6-diethyl-5-oxo-7,8-dihydronaphthalene-2-carboxylate?
The IUPAC name of methyl 6,6-diethyl-5-oxo-7,8-dihydronaphthalene-2-carboxylate (CID 102085766) is methyl 6,6-diethyl-5-oxo-7,8-dihydronaphthalene-2-carboxylate.
What is the SMILES notation for methyl 6,6-diethyl-5-oxo-7,8-dihydronaphthalene-2-carboxylate?
The canonical SMILES for methyl 6,6-diethyl-5-oxo-7,8-dihydronaphthalene-2-carboxylate is CCC1(CC)CCc2cc(C(=O)OC)ccc2C1=O.
What is the InChIKey of methyl 6,6-diethyl-5-oxo-7,8-dihydronaphthalene-2-carboxylate?
The InChIKey is VRBNTNJAWXPWEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20O3/c1-4-16(5-2)9-8-11-10-12(15(18)19-3)6-7-13(11)14(16)17/h6-7,10H,4-5,8-9H2,1-3H3.
What are the key properties of methyl 6,6-diethyl-5-oxo-7,8-dihydronaphthalene-2-carboxylate?
methyl 6,6-diethyl-5-oxo-7,8-dihydronaphthalene-2-carboxylate has a molecular weight of 260.33 g/mol, XLogP of 3.41, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6,6-diethyl-5-oxo-7,8-dihydronaphthalene-2-carboxylate is sourced from PubChem (CID 102085766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).