methyl 1,1,4-trioxo-2,3-dihydrothiochromene-7-carboxylate

C11H10O5S — CID 19354747

IUPACmethyl 1,1,4-trioxo-2,3-dihydrothiochromene-7-carboxylate
SMILESCOC(=O)c1ccc2c(c1)S(=O)(=O)CCC2=O
InChIInChI=1S/C11H10O5S/c1-16-11(13)7-2-3-8-9(12)4-5-17(14,15)10(8)6-7/h2-3,6H,4-5H2,1H3
InChIKeyRVYQWKHDOAVHCM-UHFFFAOYSA-N
MW254.26 g/mol
LogP0.83
Rot. Bonds1

About methyl 1,1,4-trioxo-2,3-dihydrothiochromene-7-carboxylate

methyl 1,1,4-trioxo-2,3-dihydrothiochromene-7-carboxylate (PubChem CID 19354747) has the molecular formula C11H10O5S and a molecular weight of 254.26 g/mol. Its IUPAC name is methyl 1,1,4-trioxo-2,3-dihydrothiochromene-7-carboxylate.

Molecular Properties

Compound Namemethyl 1,1,4-trioxo-2,3-dihydrothiochromene-7-carboxylate
PubChem CID19354747
Molecular FormulaC11H10O5S
Molecular Weight254.26 g/mol
Exact Mass254.02
IUPAC Namemethyl 1,1,4-trioxo-2,3-dihydrothiochromene-7-carboxylate
SMILESCOC(=O)c1ccc2c(c1)S(=O)(=O)CCC2=O
InChIInChI=1S/C11H10O5S/c1-16-11(13)7-2-3-8-9(12)4-5-17(14,15)10(8)6-7/h2-3,6H,4-5H2,1H3
InChIKeyRVYQWKHDOAVHCM-UHFFFAOYSA-N
XLogP0.83
TPSA77.51 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500254.26
LogP ≤ 50.83
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 1,1,4-trioxo-2,3-dihydrothiochromene-7-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 1,1,4-trioxo-2,3-dihydrothiochromene-7-carboxylate?
The IUPAC name of methyl 1,1,4-trioxo-2,3-dihydrothiochromene-7-carboxylate (CID 19354747) is methyl 1,1,4-trioxo-2,3-dihydrothiochromene-7-carboxylate.
What is the SMILES notation for methyl 1,1,4-trioxo-2,3-dihydrothiochromene-7-carboxylate?
The canonical SMILES for methyl 1,1,4-trioxo-2,3-dihydrothiochromene-7-carboxylate is COC(=O)c1ccc2c(c1)S(=O)(=O)CCC2=O.
What is the InChIKey of methyl 1,1,4-trioxo-2,3-dihydrothiochromene-7-carboxylate?
The InChIKey is RVYQWKHDOAVHCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O5S/c1-16-11(13)7-2-3-8-9(12)4-5-17(14,15)10(8)6-7/h2-3,6H,4-5H2,1H3.
What are the key properties of methyl 1,1,4-trioxo-2,3-dihydrothiochromene-7-carboxylate?
methyl 1,1,4-trioxo-2,3-dihydrothiochromene-7-carboxylate has a molecular weight of 254.26 g/mol, XLogP of 0.83, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1,1,4-trioxo-2,3-dihydrothiochromene-7-carboxylate is sourced from PubChem (CID 19354747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).