C11H14O3S — CID 90931933
1,1-dioxo-2,3-dihydrothiochromen-4-one;ethane (PubChem CID 90931933) has the molecular formula C11H14O3S and a molecular weight of 226.30 g/mol. Its IUPAC name is 1,1-dioxo-2,3-dihydrothiochromen-4-one;ethane.
| Compound Name | 1,1-dioxo-2,3-dihydrothiochromen-4-one;ethane |
|---|---|
| PubChem CID | 90931933 |
| Molecular Formula | C11H14O3S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | 1,1-dioxo-2,3-dihydrothiochromen-4-one;ethane |
| SMILES | CC.O=C1CCS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C9H8O3S.C2H6/c10-8-5-6-13(11,12)9-4-2-1-3-7(8)9;1-2/h1-4H,5-6H2;1-2H3 |
| InChIKey | SFJWBIXGQBVGAK-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |