About 6-chloro-1,1-dioxo-2,3-dihydrothiochromen-4-one
6-chloro-1,1-dioxo-2,3-dihydrothiochromen-4-one (PubChem CID 2739106) has the molecular formula C9H7ClO3S
and a molecular weight of 230.67 g/mol. Its IUPAC name is 6-chloro-1,1-dioxo-2,3-dihydrothiochromen-4-one.
Molecular Properties
| Compound Name | 6-chloro-1,1-dioxo-2,3-dihydrothiochromen-4-one |
| PubChem CID | 2739106 |
| Molecular Formula | C9H7ClO3S |
| Molecular Weight | 230.67 g/mol |
| Exact Mass | 229.98 |
| IUPAC Name | 6-chloro-1,1-dioxo-2,3-dihydrothiochromen-4-one |
| SMILES | O=C1CCS(=O)(=O)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C9H7ClO3S/c10-6-1-2-9-7(5-6)8(11)3-4-14(9,12)13/h1-2,5H,3-4H2 |
| InChIKey | ZFZPMYLZPMMUQA-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.67 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-chloro-1,1-dioxo-2,3-dihydrothiochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-1,1-dioxo-2,3-dihydrothiochromen-4-one?
The IUPAC name of 6-chloro-1,1-dioxo-2,3-dihydrothiochromen-4-one (CID 2739106) is 6-chloro-1,1-dioxo-2,3-dihydrothiochromen-4-one.
What is the SMILES notation for 6-chloro-1,1-dioxo-2,3-dihydrothiochromen-4-one?
The canonical SMILES for 6-chloro-1,1-dioxo-2,3-dihydrothiochromen-4-one is O=C1CCS(=O)(=O)c2ccc(Cl)cc21.
What is the InChIKey of 6-chloro-1,1-dioxo-2,3-dihydrothiochromen-4-one?
The InChIKey is ZFZPMYLZPMMUQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7ClO3S/c10-6-1-2-9-7(5-6)8(11)3-4-14(9,12)13/h1-2,5H,3-4H2.
What are the key properties of 6-chloro-1,1-dioxo-2,3-dihydrothiochromen-4-one?
6-chloro-1,1-dioxo-2,3-dihydrothiochromen-4-one has a molecular weight of 230.67 g/mol, XLogP of 1.70, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-1,1-dioxo-2,3-dihydrothiochromen-4-one is sourced from PubChem (CID 2739106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).