C10H9NO4S — CID 70322772
methyl 3-imino-1,1-dioxo-1-benzothiophene-6-carboxylate (PubChem CID 70322772) has the molecular formula C10H9NO4S and a molecular weight of 239.25 g/mol. Its IUPAC name is methyl 3-imino-1,1-dioxo-1-benzothiophene-6-carboxylate.
| Compound Name | methyl 3-imino-1,1-dioxo-1-benzothiophene-6-carboxylate |
|---|---|
| PubChem CID | 70322772 |
| Molecular Formula | C10H9NO4S |
| Molecular Weight | 239.25 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | methyl 3-imino-1,1-dioxo-1-benzothiophene-6-carboxylate |
| SMILES | [H]/N=C1\CS(=O)(=O)c2cc(C(=O)OC)ccc21 |
| InChI | InChI=1S/C10H9NO4S/c1-15-10(12)6-2-3-7-8(11)5-16(13,14)9(7)4-6/h2-4,11H,5H2,1H3/b11-8+ |
| InChIKey | VJBSJHTUPJUHBJ-DHZHZOJOSA-N |
| XLogP | 0.63 |
| TPSA | 84.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.25 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|