About methyl 4-ethyl-1,1,3-trioxo-1λ6,4-benzothiazine-6-carboxylate
methyl 4-ethyl-1,1,3-trioxo-1λ6,4-benzothiazine-6-carboxylate (PubChem CID 67635979) has the molecular formula C12H13NO5S
and a molecular weight of 283.31 g/mol. Its IUPAC name is methyl 4-ethyl-1,1,3-trioxo-1λ6,4-benzothiazine-6-carboxylate.
Analyze methyl 4-ethyl-1,1,3-trioxo-1λ6,4-benzothiazine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-ethyl-1,1,3-trioxo-1λ6,4-benzothiazine-6-carboxylate?
The IUPAC name of methyl 4-ethyl-1,1,3-trioxo-1λ6,4-benzothiazine-6-carboxylate (CID 67635979) is methyl 4-ethyl-1,1,3-trioxo-1λ6,4-benzothiazine-6-carboxylate.
What is the SMILES notation for methyl 4-ethyl-1,1,3-trioxo-1λ6,4-benzothiazine-6-carboxylate?
The canonical SMILES for methyl 4-ethyl-1,1,3-trioxo-1λ6,4-benzothiazine-6-carboxylate is CCN1C(=O)CS(=O)(=O)c2ccc(C(=O)OC)cc21.
What is the InChIKey of methyl 4-ethyl-1,1,3-trioxo-1λ6,4-benzothiazine-6-carboxylate?
The InChIKey is PMVNYTMQCWTIOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO5S/c1-3-13-9-6-8(12(15)18-2)4-5-10(9)19(16,17)7-11(13)14/h4-6H,3,7H2,1-2H3.
What are the key properties of methyl 4-ethyl-1,1,3-trioxo-1λ6,4-benzothiazine-6-carboxylate?
methyl 4-ethyl-1,1,3-trioxo-1λ6,4-benzothiazine-6-carboxylate has a molecular weight of 283.31 g/mol, XLogP of 0.61, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-ethyl-1,1,3-trioxo-1λ6,4-benzothiazine-6-carboxylate is sourced from PubChem (CID 67635979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).