About 1,1-dioxo-7-propanoyl-4-prop-2-ynyl-1λ6,4-benzothiazin-3-one
1,1-dioxo-7-propanoyl-4-prop-2-ynyl-1λ6,4-benzothiazin-3-one (PubChem CID 84615977) has the molecular formula C14H13NO4S
and a molecular weight of 291.33 g/mol. Its IUPAC name is 1,1-dioxo-7-propanoyl-4-prop-2-ynyl-1λ6,4-benzothiazin-3-one.
Molecular Properties
| Compound Name | 1,1-dioxo-7-propanoyl-4-prop-2-ynyl-1λ6,4-benzothiazin-3-one |
| PubChem CID | 84615977 |
| Molecular Formula | C14H13NO4S |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 1,1-dioxo-7-propanoyl-4-prop-2-ynyl-1λ6,4-benzothiazin-3-one |
| SMILES | C#CCN1C(=O)CS(=O)(=O)c2cc(C(=O)CC)ccc21 |
| InChI | InChI=1S/C14H13NO4S/c1-3-7-15-11-6-5-10(12(16)4-2)8-13(11)20(18,19)9-14(15)17/h1,5-6,8H,4,7,9H2,2H3 |
| InChIKey | BCADDLDKQKZWLG-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dioxo-7-propanoyl-4-prop-2-ynyl-1λ6,4-benzothiazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dioxo-7-propanoyl-4-prop-2-ynyl-1λ6,4-benzothiazin-3-one?
The IUPAC name of 1,1-dioxo-7-propanoyl-4-prop-2-ynyl-1λ6,4-benzothiazin-3-one (CID 84615977) is 1,1-dioxo-7-propanoyl-4-prop-2-ynyl-1λ6,4-benzothiazin-3-one.
What is the SMILES notation for 1,1-dioxo-7-propanoyl-4-prop-2-ynyl-1λ6,4-benzothiazin-3-one?
The canonical SMILES for 1,1-dioxo-7-propanoyl-4-prop-2-ynyl-1λ6,4-benzothiazin-3-one is C#CCN1C(=O)CS(=O)(=O)c2cc(C(=O)CC)ccc21.
What is the InChIKey of 1,1-dioxo-7-propanoyl-4-prop-2-ynyl-1λ6,4-benzothiazin-3-one?
The InChIKey is BCADDLDKQKZWLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO4S/c1-3-7-15-11-6-5-10(12(16)4-2)8-13(11)20(18,19)9-14(15)17/h1,5-6,8H,4,7,9H2,2H3.
What are the key properties of 1,1-dioxo-7-propanoyl-4-prop-2-ynyl-1λ6,4-benzothiazin-3-one?
1,1-dioxo-7-propanoyl-4-prop-2-ynyl-1λ6,4-benzothiazin-3-one has a molecular weight of 291.33 g/mol, XLogP of 1.03, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dioxo-7-propanoyl-4-prop-2-ynyl-1λ6,4-benzothiazin-3-one is sourced from PubChem (CID 84615977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).