C15H14N2O3S — CID 10709482
N,10-dimethyl-5,5-dioxophenothiazine-3-carboxamide (PubChem CID 10709482) has the molecular formula C15H14N2O3S and a molecular weight of 302.36 g/mol. Its IUPAC name is N,10-dimethyl-5,5-dioxophenothiazine-3-carboxamide.
| Compound Name | N,10-dimethyl-5,5-dioxophenothiazine-3-carboxamide |
|---|---|
| PubChem CID | 10709482 |
| Molecular Formula | C15H14N2O3S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | N,10-dimethyl-5,5-dioxophenothiazine-3-carboxamide |
| SMILES | CNC(=O)c1ccc2c(c1)S(=O)(=O)c1ccccc1N2C |
| InChI | InChI=1S/C15H14N2O3S/c1-16-15(18)10-7-8-12-14(9-10)21(19,20)13-6-4-3-5-11(13)17(12)2/h3-9H,1-2H3,(H,16,18) |
| InChIKey | TZMXVDVMFMQZDG-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |