C14H12N2OS — CID 10634829
N-methyl-10H-phenothiazine-3-carboxamide (PubChem CID 10634829) has the molecular formula C14H12N2OS and a molecular weight of 256.33 g/mol. Its IUPAC name is N-methyl-10H-phenothiazine-3-carboxamide.
| Compound Name | N-methyl-10H-phenothiazine-3-carboxamide |
|---|---|
| PubChem CID | 10634829 |
| Molecular Formula | C14H12N2OS |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | N-methyl-10H-phenothiazine-3-carboxamide |
| SMILES | CNC(=O)c1ccc2c(c1)Sc1ccccc1N2 |
| InChI | InChI=1S/C14H12N2OS/c1-15-14(17)9-6-7-11-13(8-9)18-12-5-3-2-4-10(12)16-11/h2-8,16H,1H3,(H,15,17) |
| InChIKey | SOYRMBLAEHNYOD-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |