C9H8N2O4S — CID 24693634
methyl 3-amino-1,1-dioxo-1,2-benzothiazole-6-carboxylate (PubChem CID 24693634) has the molecular formula C9H8N2O4S and a molecular weight of 240.24 g/mol. Its IUPAC name is methyl 3-amino-1,1-dioxo-1,2-benzothiazole-6-carboxylate.
| Compound Name | methyl 3-amino-1,1-dioxo-1,2-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 24693634 |
| Molecular Formula | C9H8N2O4S |
| Molecular Weight | 240.24 g/mol |
| Exact Mass | 240.02 |
| IUPAC Name | methyl 3-amino-1,1-dioxo-1,2-benzothiazole-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)S(=O)(=O)N=C2N |
| InChI | InChI=1S/C9H8N2O4S/c1-15-9(12)5-2-3-6-7(4-5)16(13,14)11-8(6)10/h2-4H,1H3,(H2,10,11) |
| InChIKey | UAVJBSQIUBGIIL-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.24 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |