C13H11NO3 — CID 140747764
methyl 8-hydroxy-7-isocyano-5,6-dihydronaphthalene-2-carboxylate (PubChem CID 140747764) has the molecular formula C13H11NO3 and a molecular weight of 229.23 g/mol. Its IUPAC name is methyl 8-hydroxy-7-isocyano-5,6-dihydronaphthalene-2-carboxylate.
| Compound Name | methyl 8-hydroxy-7-isocyano-5,6-dihydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 140747764 |
| Molecular Formula | C13H11NO3 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | methyl 8-hydroxy-7-isocyano-5,6-dihydronaphthalene-2-carboxylate |
| SMILES | [C-]#[N+]C1=C(O)c2cc(C(=O)OC)ccc2CC1 |
| InChI | InChI=1S/C13H11NO3/c1-14-11-6-5-8-3-4-9(13(16)17-2)7-10(8)12(11)15/h3-4,7,15H,5-6H2,2H3 |
| InChIKey | HISGFQFVUPOGPS-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 50.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|