C13H14O2 — CID 58055424
methyl 7-methyl-5,6-dihydronaphthalene-2-carboxylate (PubChem CID 58055424) has the molecular formula C13H14O2 and a molecular weight of 202.25 g/mol. Its IUPAC name is methyl 7-methyl-5,6-dihydronaphthalene-2-carboxylate.
| Compound Name | methyl 7-methyl-5,6-dihydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 58055424 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | methyl 7-methyl-5,6-dihydronaphthalene-2-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)C=C(C)CC2 |
| InChI | InChI=1S/C13H14O2/c1-9-3-4-10-5-6-11(13(14)15-2)8-12(10)7-9/h5-8H,3-4H2,1-2H3 |
| InChIKey | UBECMLDAGXGROQ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |