About methyl 7-methyl-5,6-dihydronaphthalene-2-carboxylate
methyl 7-methyl-5,6-dihydronaphthalene-2-carboxylate (PubChem CID 58055424) has the molecular formula C13H14O2
and a molecular weight of 202.25 g/mol. Its IUPAC name is methyl 7-methyl-5,6-dihydronaphthalene-2-carboxylate.
Molecular Properties
| Compound Name | methyl 7-methyl-5,6-dihydronaphthalene-2-carboxylate |
| PubChem CID | 58055424 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | methyl 7-methyl-5,6-dihydronaphthalene-2-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)C=C(C)CC2 |
| InChI | InChI=1S/C13H14O2/c1-9-3-4-10-5-6-11(13(14)15-2)8-12(10)7-9/h5-8H,3-4H2,1-2H3 |
| InChIKey | UBECMLDAGXGROQ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methyl 7-methyl-5,6-dihydronaphthalene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-methyl-5,6-dihydronaphthalene-2-carboxylate?
The IUPAC name of methyl 7-methyl-5,6-dihydronaphthalene-2-carboxylate (CID 58055424) is methyl 7-methyl-5,6-dihydronaphthalene-2-carboxylate.
What is the SMILES notation for methyl 7-methyl-5,6-dihydronaphthalene-2-carboxylate?
The canonical SMILES for methyl 7-methyl-5,6-dihydronaphthalene-2-carboxylate is COC(=O)c1ccc2c(c1)C=C(C)CC2.
What is the InChIKey of methyl 7-methyl-5,6-dihydronaphthalene-2-carboxylate?
The InChIKey is UBECMLDAGXGROQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O2/c1-9-3-4-10-5-6-11(13(14)15-2)8-12(10)7-9/h5-8H,3-4H2,1-2H3.
What are the key properties of methyl 7-methyl-5,6-dihydronaphthalene-2-carboxylate?
methyl 7-methyl-5,6-dihydronaphthalene-2-carboxylate has a molecular weight of 202.25 g/mol, XLogP of 2.82, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-methyl-5,6-dihydronaphthalene-2-carboxylate is sourced from PubChem (CID 58055424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).